Trimethoxy (pentamethylcyclopentadienyl) titanium (IV)
Synonym: Cp*Ti(OMe)3, Ti(CpMe5)(OMe)3, (Pentamethylcyclopentadienyl)Titanium Trimethoxide
Overview
Ereztech manufactures and sells this product in small and bulk volumes. Glass ampules, bottles or metal ampules or bubblers are available for packaging. For additional analytical information or details about purchasing Trimethoxy (pentamethylcyclopentadienyl) titanium (IV) contact us at sales@ereztech.com
| Product Code | TI7753 |
| Product Name | Trimethoxy (pentamethylcyclopentadienyl) titanium (IV) |
| CAS Number | 123927-75-3 |
| Molecular formula | C13H24O3Ti |
| Linear formula | C13H24O3Ti |
| Molecular weight | 276.21 |
| Form | liquid |
| Boiling point | 285C |
| NMR | conforms to structure |
Test Specification
| Assay (purity) | 98%+ |
| Purity method | by integration NMR |
| Metal purity | 99.9%-Ti |
| Appearance | yellow liquid |
Safety Information
| Signal word | WARNING |
| Hazard statements | H278 |
| Precautionary statements | P210, P233, P240, P241, P242, P243, P280, P303 + P361 + P353, P370 + P378, P403 + P235, P501 |
| UN | 1993 |
| Transport description | FLAMMABLE LIQUIDS, N.O.S. (Trimethoxy(pentamethylcyclopentadienyl) titanium(IV) |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 61C |
External Identifiers for Cp*Ti(OMe)3
| Pubchem CID | 10989493 |
| SMILES | C[C]1[C]([C]([C]([C]1C)C)C)C.CO[Ti](OC)OC |
| IUPAC Name | methanol; 1,2,3,4,5-pentamethylcyclopentane; titanium |
| InchI Identifier | InChI=1S/C10H15.3CH3O.Ti/c1-6-7(2)9(4)10(5)8(6)3;3*1-2;/h1-5H3;3*1H3;/q;3*-1;+3 |
| InchI Key | KYPOTCHOVIFPTJ-UHFFFAOYSA-N |
| MDL Number | MFCD00269850 |
| EC Number | 680-405-2 |