CAS Number 942311-35-5
For more details check the specification page: Nickel(II) 1-dimethylamino-2-methyl-2-butoxide
Chemical identifiers
| Linear formula | C14H32N2O2Ni |
| Pubchem CID | 89558561 |
| SMILES | CCC(C)(CN(C)C)[O-].CCC(C)(CN(C)C)[O-].[Ni+2] |
| IUPAC Name | 1-(dimethylamino)-2-methylbutan-2-olate;nickel(2+) |
| InchI Identifier | InChI=1S/2C7H16NO.Ni/c2*1-5-7(2,9)6-8(3)4;/h2*5-6H2,1-4H3;/q2*-1;+2 |
| InchI Key | LECAMOYWYJUYIH-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H315, H319, H334, H335, H372 |
| Precautionary statements | P223, P260, P264 + P265, P270, P271, P280, P284, P302 + P352, P304 + P340, P305 + P351 + P338, P319, P332 + P317, P337 + P317, P342 + P316, P362 + P364, P403 + P233, P405, P501 |
| UN | 3148 |
| Transport description | WATER-REACTIVE LIQUID, N.O.S. (Nickel(II) 1- dimethylamino-2-methyl-2-butoxide) |
| Hazardous class | 4.3 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |