1,2-Bis (diisopropylamino) disilane
Synonym: BDIPADS, 1,2-Disilanediamine, N,N,N′,N′-tetrakis(1-methylethyl), N1,N1,N2,N2-Tetrakis(1-methylethyl)-1,2-disilanediamine
Overview
Ereztech manufactures and sells this product in small and bulk volumes. Glass ampules, bottles or metal ampules or bubblers are available for packaging. For additional analytical information or details about purchasing 1,2-Bis (diisopropylamino) disilane contact us at sales@ereztech.com
| Product Code | SI5262 |
| Product Name | 1,2-Bis (diisopropylamino) disilane |
| CAS Number | 151625-26-2 |
| Molecular formula | C12H32N2Si2 |
| Linear formula | C12H32N2Si2 |
| Molecular weight | 260.57 |
| Form | liquid |
| Boiling point | 235C/760 torr |
| Sensitivity | moisture, heat |
Test Specification
| Assay (purity) | 99% |
| Purity method | by GC |
| Metal purity | 99.9999%-Si |
| Appearance | colorless liquid |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H225, H261, H314, H318, H335 |
| Precautionary statements | P210, P223, P231 + P232, P233, P240, P241, P242, P243, P260, P264 + P265, P271, P280, P301 + P330 + P331, P302 + P335 + P334, P302 + P361 + P354, P304 + P340, P305 + P354 + P338, P316, P363, P370 + P378, P402 + P404, P403 + P233 + P235, P405, P501 |
| In TSCA registry | No (sold for research and development usage only) |
External Identifiers for BDIPADS
| SMILES | N([SiH2][SiH2]N(C(C)C)C(C)C)(C(C)C)C(C)C |
| InchI Identifier | InChI=1S/C12H32N2Si2/c1-9(2)13(10(3)4)15-16-14(11(5)6)12(7)8/h9-12H,15-16H2,1-8H3 |
| InchI Key | SHJLMBCQMMQSAA-UHFFFAOYSA-N |