CAS Number 1272-23-7
For more details check the specification page: Tris(methylcyclopentadienyl)lanthanum(III)
Chemical identifiers
| Linear formula | La(C6H7)3 |
| Pubchem CID | 22564672 |
| SMILES | CC1=C(CC=C1)[La](C1=C(C=CC1)C)C1=C(C=CC1)C |
| IUPAC Name | lanthanum(3+);2-methylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/3C6H7.La/c3*1-6-4-2-3-5-6;/h3*2,4H,3H2,1H3;/q3*-1;+3 |
| InchI Key | MZFUOSYONYIKFU-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| UN | 1325 |
| Transport description | FLAMMABLE SOLID, ORGANIC, N.O.S. |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |