CAS Number 107333-47-1
For more details check the specification page: (Trimethyl)pentamethylcyclopentadienyltitanium(IV)
Chemical identifiers
| Linear formula | (CH3)5C5Ti(CH3)3 |
| Pubchem CID | 56846032 |
| SMILES | [CH3-].[CH3-].[CH3-].C[C]1[C]([C]([C]([C]1C)C)C)C.[Ti+3] |
| IUPAC Name | carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium(3+) |
| InchI Identifier | InChI=1S/C10H15.3CH3.Ti/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H3;/q;3*-1;+3 |
| InchI Key | URQIVZBTTCUDJZ-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H228 |
| Precautionary statements | P231, P235, P301, P305, P310, P338, P351, P410, P422, P501 |
| UN | 1325 |
| Transport description | FLAMMABLE SOLIDS, ORGANIC, N.O.S. |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |