CAS Number 12129-06-5
For more details check the specification page: Pentamethylcyclopentadienyltitanium trichloride
Chemical identifiers
| Linear formula | C10H15Cl3Ti |
| Pubchem CID | 16212911 |
| SMILES | [Ti](Cl)(Cl)Cl.[C]1([C]([C]([C]([C]1C)C)C)C)C |
| IUPAC Name | 1,2,3,4,5-pentamethylcyclopentane; trichlorotitanium |
| InchI Identifier | InChI=1S/C10H15.3ClH.Ti/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q;;;;+3/p-3 |
| InchI Key | QCEOZLISXJGWSW-UHFFFAOYSA-K |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| UN | 3261 |
| Transport description | CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S. (Pentamethylcyclopent adienyltitanium trichloride) |
| Hazardous class | 8 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |