CAS Number 82495-67-8
For more details check the specification page: 1,2-Bis(dichlorophosphino)benzene
Chemical identifiers
| Linear formula | C6H4Cl4P2 |
| Pubchem CID | 3316562 |
| SMILES | ClP(Cl)C1=C(P(Cl)Cl)C=CC=C1 |
| IUPAC Name | dichloro-(2-dichlorophosphanylphenyl)phosphane |
| InchI Identifier | InChI=1S/C6H4Cl4P2/c7-11(8)5-3-1-2-4-6(5)12(9)10/h1-4H |
| InchI Key | IGYHSFVSIYJSML-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| UN | 3265 |
| Transport description | CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S. (1,2-Bis(dichlorophosphino)benzene) |
| Hazardous class | 8 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | >110C |